- 8-Nonenoic Acid
-
- $2.20 / 50kg
-
2025-10-13
- CAS:31642-67-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 50kg
- 8-NONENOIC ACID
-
- $0.00 / 25KG
-
2025-07-25
- CAS:31642-67-8
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
- 8-NONENOIC ACID
-
- $0.00 / 200KG
-
2025-06-27
- CAS:31642-67-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
|
| | 8-NONENOIC ACID Basic information |
| Product Name: | 8-NONENOIC ACID | | Synonyms: | 8-Nonenoic acid 97%;8-NONENOIC ACID;NONENOIC ACID (8-);8-nonene-1-acid;non-8-enoicaci | | CAS: | 31642-67-8 | | MF: | C9H16O2 | | MW: | 156.22 | | EINECS: | | | Product Categories: | | | Mol File: | 31642-67-8.mol |  |
| | 8-NONENOIC ACID Chemical Properties |
| Melting point | 2.5°C | | Boiling point | 274.02°C (estimate) | | density | 0.908 g/mL at 25 °C | | refractive index | n20/D1.444 | | Fp | >110℃ | | form | liquid | | pka | 4.78±0.10(Predicted) | | InChI | InChI=1S/C9H16O2/c1-2-3-4-5-6-7-8-9(10)11/h2H,1,3-8H2,(H,10,11) | | InChIKey | AWQOXJOAQMCOED-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCCCC=C |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 |
| | 8-NONENOIC ACID Usage And Synthesis |
| Uses | 8-?Nonenoic Acid is a reagent used in the synthesis of 4-N-Alkyl Gemcitabine (G305000) analogs, which act as antineoplastics. | | Definition | ChEBI: 8-nonylenic acid is a medium-chain fatty acid. | | Synthesis Reference(s) | Synthetic Communications, 9, p. 63, 1979 DOI: 10.1080/00397917908064130 |
| | 8-NONENOIC ACID Preparation Products And Raw materials |
|