- Fmoc-L-Glu(OBzl)-OH
-
- $0.00/ kg
-
2025-12-31
- CAS:123639-61-2
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
|
| | Fmoc-L-glutamic acid-gamma-benzyl ester Basic information |
| | Fmoc-L-glutamic acid-gamma-benzyl ester Chemical Properties |
| Melting point | Decomposes | | Boiling point | 698.2±55.0 °C(Predicted) | | density | 1.289±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 3.70±0.10(Predicted) | | color | White to off-white | | Optical Rotation | [α]20/D +12.0±2.5°, c =1% in chloroform | | InChIKey | HJJURMMMGPQIQP-DEOSSOPVSA-N | | SMILES | C(O)(=O)[C@H](CCC(OCC1=CC=CC=C1)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 123639-61-2(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2924 29 70 |
| | Fmoc-L-glutamic acid-gamma-benzyl ester Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Fmoc-glu(obzl)-oh, is an amino acid derivative used in chemical synthesis and peptide chemistry. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-L-glutamic acid-gamma-benzyl ester Preparation Products And Raw materials |
|