| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| | NG,NGμ-Dimethyl-L-arginine di(p-hydroxyazobenzene-pμ-sulfonate) salt Basic information |
| | NG,NGμ-Dimethyl-L-arginine di(p-hydroxyazobenzene-pμ-sulfonate) salt Chemical Properties |
| storage temp. | room temp | | solubility | methanol: 10mg/mL | | form | powder | | biological source | synthetic (organic) | | InChIKey | HISUXCNNXYEHER-YJSASASGSA-N | | SMILES | CN\C(NC)=N\CCC[C@H](N)C(O)=O.Oc1ccc(cc1)\N=N\c2ccc(cc2)S(O)(=O)=O.Oc3ccc(cc3)\N=N\c4ccc(cc4)S(O)(=O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | NG,NGμ-Dimethyl-L-arginine di(p-hydroxyazobenzene-pμ-sulfonate) salt Usage And Synthesis |
| Uses | Plasma sym-dimethylarginine has been considered a marker of hepatic and renal dysfunction. A sensitive LC-MS method for identifying arginine, and both asym- and sym-dimethylarginine in plasma and urine samples has been developed. | | IC 50 | Human Endogenous Metabolite |
| | NG,NGμ-Dimethyl-L-arginine di(p-hydroxyazobenzene-pμ-sulfonate) salt Preparation Products And Raw materials |
|