| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-amino-[1,1'-biphenyl]-4,4'-dicarboxylic acid Basic information |
| Product Name: | 2-amino-[1,1'-biphenyl]-4,4'-dicarboxylic acid | | Synonyms: | 2-amino-[1,1'-biphenyl]-4,4'-dicarboxylic acid;2-Amino-4,4'-biphenyldicarboxylic acid, 98%;[1,1'-Biphenyl]-4,4'-dicarboxylic acid, 2-amino-;2-Aminobiphenyl-4,4'-dicarboxylic Acid;DK7500;3-amino-4-(4-carboxyphenyl)benzoic acid;2-amino-4，4'-biphenyldimacetic acid;2-Amino-4,4'-biphenyldicarboxylic acid | | CAS: | 1240557-01-0 | | MF: | C14H11NO4 | | MW: | 257.24 | | EINECS: | | | Product Categories: | | | Mol File: | 1240557-01-0.mol | ![2-amino-[1,1'-biphenyl]-4,4'-dicarboxylic acid Structure](CAS/20180531/GIF/1240557-01-0.gif) |
| | 2-amino-[1,1'-biphenyl]-4,4'-dicarboxylic acid Chemical Properties |
| Boiling point | 526.7±50.0 °C(Predicted) | | density | 1.352-1.47 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 4.09±0.10(Predicted) | | Appearance | Light yellow to green yellow Solid | | InChI | InChI=1S/C14H11NO4/c15-12-7-10(14(18)19)5-6-11(12)8-1-3-9(4-2-8)13(16)17/h1-7H,15H2,(H,16,17)(H,18,19) | | InChIKey | FYEKGZUXGKAJJQ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(C(O)=O)C=C2)=CC=C(C(O)=O)C=C1N |
| | 2-amino-[1,1'-biphenyl]-4,4'-dicarboxylic acid Usage And Synthesis |
| Uses | 2-Amino-[1,1'-biphenyl]-4,4'-dicarboxylic acid can be used as ligands in the synthesis of MOF materials: UiO-67-m-NH2; DUT-5amine; N3/NH2-bMOF-100. |
| | 2-amino-[1,1'-biphenyl]-4,4'-dicarboxylic acid Preparation Products And Raw materials |
|