| Company Name: |
Guangzhou Liwen Technology Co., Ltd. Gold
|
| Tel: |
18028686850 |
| Email: |
404259597@qq.com |
| Products Intro: |
Product Name:10-[2-(2-Methoxyethoxy)ethyl]-10H-phenothiazine
CAS:2098786-35-5
Purity:95% Package:1g，100g，1kg，25kg，1T
|
| Company Name: |
TCI (Shanghai) Development Co., Ltd.
|
| Tel: |
021-67121386 |
| Email: |
Sales-CN@TCIchemicals.com |
| Products Intro: |
Product Name:10-[2-(2-Methoxyethoxy)ethyl]-10H-phenothiazine
CAS:2098786-35-5
Purity:98.0% GC Package:10G
|
|
| | 10-[2-(2-Methoxyethoxy)ethyl]-10H-phenothiazine Basic information |
| | 10-[2-(2-Methoxyethoxy)ethyl]-10H-phenothiazine Chemical Properties |
| Boiling point | 434.9±38.0 °C(Predicted) | | density | 1.175±0.06 g/cm3(Predicted) | | refractive index | 1.6260 to 1.6300 | | storage temp. | 2-8°C, protect from light | | pka | 0.26±0.20(Predicted) | | form | clear liquid | | color | Light yellow to Yellow to Orange | | InChI | InChI=1S/C17H19NO2S/c1-19-12-13-20-11-10-18-14-6-2-4-8-16(14)21-17-9-5-3-7-15(17)18/h2-9H,10-13H2,1H3 | | InChIKey | XWOTZCDVQAKOAY-UHFFFAOYSA-N | | SMILES | C1=C2C(SC3=C(N2CCOCCOC)C=CC=C3)=CC=C1 |
| | 10-[2-(2-Methoxyethoxy)ethyl]-10H-phenothiazine Usage And Synthesis |
| | 10-[2-(2-Methoxyethoxy)ethyl]-10H-phenothiazine Preparation Products And Raw materials |
|