| Company Name: |
AbaChemScene |
| Tel: |
732-484-9848 |
| Email: |
sales@chemscene.com |
|
| | 3-(2-Methylphenyl)-2-((Z)-propylimino)thiazolidin-4-one Basic information |
| Product Name: | 3-(2-Methylphenyl)-2-((Z)-propylimino)thiazolidin-4-one | | Synonyms: | 3-(2-Methylphenyl)-2-((Z)-propylimino)thiazolidin-4-one;(E)-2-(propylimino)-3-(o-tolyl)thiazolidin-4-one;4-Thiazolidinone, 3-(2-methylphenyl)-2-(propylimino)-, (2Z)-;(Z) -2- (propylimino) -3- (o-methylphenyl) thiazolidine-4-one;CAS:854107-53-2;(Z)-2-(Propyl imino)-3-(o-Tolyl)Thiazolidine-4-ketone | | CAS: | 854107-53-2 | | MF: | C13H16N2OS | | MW: | 248.35 | | EINECS: | | | Product Categories: | | | Mol File: | 854107-53-2.mol |  |
| | 3-(2-Methylphenyl)-2-((Z)-propylimino)thiazolidin-4-one Chemical Properties |
| Melting point | 59 °C(Solv: ethyl ether (60-29-7); heptane (142-82-5)) | | Boiling point | 362.2±35.0 °C(Predicted) | | density | 1.18±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 0.96±0.20(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C13H16N2OS/c1-3-8-14-13-15(12(16)9-17-13)11-7-5-4-6-10(11)2/h4-7H,3,8-9H2,1-2H3/b14-13- | | InChIKey | OYBHACSOBWDLDC-YPKPFQOOSA-N | | SMILES | S1CC(=O)N(C2=CC=CC=C2C)/C/1=N/CCC |
| | 3-(2-Methylphenyl)-2-((Z)-propylimino)thiazolidin-4-one Usage And Synthesis |
| | 3-(2-Methylphenyl)-2-((Z)-propylimino)thiazolidin-4-one Preparation Products And Raw materials |
|