|
|
| | 1,3,6,8-tetra(pyridin-4-yl)pyrene Basic information |
| Product Name: | 1,3,6,8-tetra(pyridin-4-yl)pyrene | | Synonyms: | 1,3,6,8-tetra(pyridin-4-yl)pyrene;4-[3,6,8-tris(pyridin-4-yl)pyren-1-yl]pyridine;Pyridine, 4,4',4'',4'''-(1,3,6,8-pyrenetetrayl)tetrakis-;DK7644 | | CAS: | 1402429-80-4 | | MF: | C36H22N4 | | MW: | 510.59 | | EINECS: | | | Product Categories: | | | Mol File: | 1402429-80-4.mol |  |
| | 1,3,6,8-tetra(pyridin-4-yl)pyrene Chemical Properties |
| Boiling point | 681.0±50.0 °C(Predicted) | | density | 1.289±0.06 g/cm3(Predicted) | | pka | 5.22±0.10(Predicted) | | InChI | InChI=1S/C36H22N4/c1-2-28-32(24-7-15-38-16-8-24)22-34(26-11-19-40-20-12-26)30-4-3-29-33(25-9-17-39-18-10-25)21-31(23-5-13-37-14-6-23)27(1)35(29)36(28)30/h1-22H | | InChIKey | LKYWKMLWYLQWJF-UHFFFAOYSA-N | | SMILES | C1(C2C=CN=CC=2)=C2C3=C4C(C=C2)=C(C2C=CN=CC=2)C=C(C2C=CN=CC=2)C4=CC=C3C(C2C=CN=CC=2)=C1 |
| | 1,3,6,8-tetra(pyridin-4-yl)pyrene Usage And Synthesis |
| Uses | 1,3,6,8-Tetra(pyridin-4-yl)pyrene is used as a ligand in the synthesis of MOF materials. |
| | 1,3,6,8-tetra(pyridin-4-yl)pyrene Preparation Products And Raw materials |
|