| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | 4-(pyridin-4-yl)-N,N-bis[4-(pyridin-4-yl)phenyl]aniline Basic information |
| | 4-(pyridin-4-yl)-N,N-bis[4-(pyridin-4-yl)phenyl]aniline Chemical Properties |
| Boiling point | 692.2±55.0 °C(Predicted) | | density | 1.203±0.06 g/cm3(Predicted) | | storage temp. | RT, protect from light | | pka | 6.05±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C33H24N4/c1-7-31(8-2-25(1)28-13-19-34-20-14-28)37(32-9-3-26(4-10-32)29-15-21-35-22-16-29)33-11-5-27(6-12-33)30-17-23-36-24-18-30/h1-24H | | InChIKey | CRFFXCBSBSCEPT-UHFFFAOYSA-N | | SMILES | C1(N(C2=CC=C(C3C=CN=CC=3)C=C2)C2=CC=C(C3C=CN=CC=3)C=C2)=CC=C(C2C=CN=CC=2)C=C1 |
| | 4-(pyridin-4-yl)-N,N-bis[4-(pyridin-4-yl)phenyl]aniline Usage And Synthesis |
| Uses | 4-(Pyridin-4-yl)-N,N-bis[4-(pyridin-4-yl)phenyl]aniline is used as a ligand in the synthesis of MOF materials such as NKU-121. |
| | 4-(pyridin-4-yl)-N,N-bis[4-(pyridin-4-yl)phenyl]aniline Preparation Products And Raw materials |
|