|
|
| | 4-Butyl-2-methylaniline Basic information |
| | 4-Butyl-2-methylaniline Chemical Properties |
| Boiling point | 264.3±9.0 °C(Predicted) | | density | 0.939±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | pka | 4.75±0.10(Predicted) | | form | Oil | | color | Red to Dark Brown | | InChI | InChI=1S/C11H17N/c1-3-4-5-10-6-7-11(12)9(2)8-10/h6-8H,3-5,12H2,1-2H3 | | InChIKey | JTXOXRXZCAMPHL-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(CCCC)C=C1C |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-53 | | Safety Statements | 36/37 | | WGK Germany | WGK 3 | | HS Code | 2921490090 | | Storage Class | 11 - Combustible Solids |
| | 4-Butyl-2-methylaniline Usage And Synthesis |
| Uses | 4-Butyl-2-methylaniline is used for the preparation of a number of substituted acetamides which are antagonists of MDR proteins for treatment of drug-resistant cancers. | | Biological Activity | SMIP004-7 is a cell penetrant, potent and selective ubiquinone uncompetitive inhibitor of mitochondrial Complex I (NADH:ubiquinone oxidoreductase). SMIP004-7 selectively binds to a distinct N-terminal region of Complex I catalytic subunit NDUFS2, which leads to rapid disassembly of Complex I. SMIP004-7 potently inhibits growth of triple-negative breast cancer xenografts in mice. |
| | 4-Butyl-2-methylaniline Preparation Products And Raw materials |
|