| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)-3-(1H-indol-3-yl)propanoic acid Basic information |
| | 2-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)-3-(1H-indol-3-yl)propanoic acid Chemical Properties |
| Boiling point | 606.0±50.0 °C(Predicted) | | density | 1.502±0.06 g/cm3(Predicted) | | storage temp. | +2C to +8C | | solubility | DMSO: 100mg/mL
methanol: soluble | | form | Yellow solid | | pka | 3.62±0.10(Predicted) | | color | yellow | | InChI | 1S/C19H14N2O4/c22-17-13-6-1-2-7-14(13)18(23)21(17)16(19(24)25)9-11-10-20-15-8-4-3-5-12(11)15/h1-8,10,16,20H,9H2,(H,24,25) | | InChIKey | HPTXLHAHLXOAKV-UHFFFAOYSA-N | | SMILES | [nH]1c2c(c(c1)CC(N3C(=O)c4c(cccc4)C3=O)C(=O)O)cccc2 |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | 2-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)-3-(1H-indol-3-yl)propanoic acid Usage And Synthesis |
| Uses | A cell-permeable, specific DNA methyltransferases inhibitor (IC50 = 115 nM for CpG methylase M.SssI) that displays anti-proliferative, but not cytotoxic, properties. Unlike the commonly used inhibitor 5-azacytidine, RG108 directly interacts with DNA methyltransferase active site via its carboxy group. | | General Description | A cell-permeable, specific DNA methyltransferases inhibitor (IC50 = 115 nM for CpG methylase M.SssI) that displays anti-proliferative, but not cytotoxic, properties. Unlike the commonly used inhibitor 5-azacytidine, RG108 directly interacts with DNA methyltransferase active site via its carboxy group. | | Biochem/physiol Actions | Cell permeable: yes |
| | 2-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)-3-(1H-indol-3-yl)propanoic acid Preparation Products And Raw materials |
|