|
|
| | 4,4',4'',4'''-(ethene-1,1,2,2-tetrayl)tetrabenzaldehyde Basic information |
| Product Name: | 4,4',4'',4'''-(ethene-1,1,2,2-tetrayl)tetrabenzaldehyde | | Synonyms: | 4,4',4'',4'''-(ethene-1,1,2,2-tetrayl)tetrabenzaldehyde;Benzaldehyde, 4,4',4'',4'''-(1,2-ethenediylidene)tetrakis-;TPE24;4-[1,2,2-tris(4-formylphenyl)ethenyl]benzaldehyde;Tetrakis (4-formylphenyl) ethene;Tetraaldehyde tetrastyrene;4,4',4'',4'''-(ethylene-1,1,2,2-tetrayl)tetrabenzenemethylaldehyde | | CAS: | 2170451-48-4 | | MF: | C30H20O4 | | MW: | 444.48 | | EINECS: | | | Product Categories: | | | Mol File: | 2170451-48-4.mol |  |
| | 4,4',4'',4'''-(ethene-1,1,2,2-tetrayl)tetrabenzaldehyde Chemical Properties |
| Boiling point | 631.6±55.0 °C(Predicted) | | density | 1.262±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | Appearance | Yellow to green Solid | | InChI | InChI=1S/C30H20O4/c31-17-21-1-9-25(10-2-21)29(26-11-3-22(18-32)4-12-26)30(27-13-5-23(19-33)6-14-27)28-15-7-24(20-34)8-16-28/h1-20H | | InChIKey | UKOWOFJKLANHAG-UHFFFAOYSA-N | | SMILES | C(/C1=CC=C(C=C1)C=O)(\C1=CC=C(C=C1)C=O)=C(\C1=CC=C(C=C1)C=O)/C1=CC=C(C=C1)C=O |
| | 4,4',4'',4'''-(ethene-1,1,2,2-tetrayl)tetrabenzaldehyde Usage And Synthesis |
| Uses | 4,4',4'',4'''-(Ethene-1,1,2,2-tetrayl)tetrabenzaldehyde is used as a monomer for the synthesis of COF materials: COF-ETBA-DAB. |
| | 4,4',4'',4'''-(ethene-1,1,2,2-tetrayl)tetrabenzaldehyde Preparation Products And Raw materials |
|