|
|
| | 1-(3-HYDROXYPHENYL)PIPERAZINE Basic information |
| | 1-(3-HYDROXYPHENYL)PIPERAZINE Chemical Properties |
| Melting point | 217-221 °C (lit.) | | Boiling point | 371.3±27.0 °C(Predicted) | | density | 1.141±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | solid | | pka | 10.33±0.10(Predicted) | | Appearance | White to off-white Solid | | Sensitive | Air Sensitive | | BRN | 4248583 | | InChI | InChI=1S/C10H14N2O/c13-10-3-1-2-9(8-10)12-6-4-11-5-7-12/h1-3,8,11,13H,4-7H2 | | InChIKey | AYGYICRITMSJOC-UHFFFAOYSA-N | | SMILES | C1(O)=CC=CC(N2CCNCC2)=C1 | | CAS DataBase Reference | 59817-32-2(CAS DataBase Reference) |
| Hazard Codes | Xn,C | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2933599590 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 1-(3-HYDROXYPHENYL)PIPERAZINE Usage And Synthesis |
| | 1-(3-HYDROXYPHENYL)PIPERAZINE Preparation Products And Raw materials |
|