- Panobinostat lactate
-
- $1980.00 / 50mg
-
2026-01-05
- CAS:960055-56-5
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | Panobinostat lactate Basic information |
| Product Name: | Panobinostat lactate | | Synonyms: | (E)-N-Hydroxy-3-(4-(((2-(2-methyl-1H-indol-3-yl)ethyl)amino)methyl)phenyl)acrylamide 2-hydroxypropanoate;Panobinostat lactateQ: What is
Panobinostat lactate Q: What is the CAS Number of
Panobinostat lactate | | CAS: | 960055-56-5 | | MF: | C3H6O3*C21H23N3O2 | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | 960055-56-5.mol |  |
| | Panobinostat lactate Chemical Properties |
| solubility | DMSO: 2 mg/mL, clear | | form | powder | | color | white to beige | | SMILES | OC(C(O)C)=O.ONC(/C=C/C(C=C1)=CC=C1CNCCC2=C(C)NC3=CC=CC=C23)=O |
| | Panobinostat lactate Usage And Synthesis |
| Definition | ChEBI: Panobinostat lactate is a lactate salt having panobinostat(1+) as the counterion. A histone deacetylase inhibitor used in combination with bortezomib and dexamethasone for the treatment of multiple myeloma. It has a role as an EC 3.5.1.98 (histone deacetylase) inhibitor, an antineoplastic agent and an angiogenesis modulating agent. It is a lactate salt and an organoammonium salt. It contains a panobinostat(1+). |
| | Panobinostat lactate Preparation Products And Raw materials |
|