| Company Name: |
Shang Hai Muse Health Tech Co., Ltd. Gold
|
| Tel: |
021-021-61069951-8018 13262285760 |
| Email: |
xul@musehealthtech.com |
| Products Intro: |
Product Name:N-[2-[(4S)-4,5-Dihydro-4-(1-methylethyl)-2-oxazolyl]-6-methoxyphenyl]methanesulfonamide CAS:546141-34-8 Purity:HPLC; >98.0%,ee>99.0% Package:1g;10g;100g;1kg
|
|
| | N-[2-[(4S)-4,5-Dihydro-4-(1-methylethyl)-2-oxazolyl]-6-methoxyphenyl]methanesulfonamide Basic information |
| | N-[2-[(4S)-4,5-Dihydro-4-(1-methylethyl)-2-oxazolyl]-6-methoxyphenyl]methanesulfonamide Chemical Properties |
| Melting point | 114 °C | | Boiling point | 461.8±55.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 8.38±0.10(Predicted) | | form | Solid | | color | White to Pale Beige | | InChI | InChI=1S/C14H20N2O4S/c1-9(2)11-8-20-14(15-11)10-6-5-7-12(19-3)13(10)16-21(4,17)18/h5-7,9,11,16H,8H2,1-4H3/t11-/m1/s1 | | InChIKey | YXGJTTRPXOAJEA-LLVKDONJSA-N | | SMILES | CS(NC1=C(OC)C=CC=C1C1=N[C@@H](C(C)C)CO1)(=O)=O |
| | N-[2-[(4S)-4,5-Dihydro-4-(1-methylethyl)-2-oxazolyl]-6-methoxyphenyl]methanesulfonamide Usage And Synthesis |
| Uses | N-[2-[(4S)-4,5-Dihydro-4-(1-methylethyl)-2-oxazolyl]-6-methoxyphenyl]methanesulfonamide is used as a reagent / catalyst in the total synthesis of the marine natural products halichondrin A, B, and C. |
| | N-[2-[(4S)-4,5-Dihydro-4-(1-methylethyl)-2-oxazolyl]-6-methoxyphenyl]methanesulfonamide Preparation Products And Raw materials |
|