| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 3-Amino-5-ethynylbenzenesulfonyl fluoride >=95% Basic information |
| | 3-Amino-5-ethynylbenzenesulfonyl fluoride >=95% Chemical Properties |
| Boiling point | 361.4±37.0 °C(Predicted) | | density | 1.46±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | form | powder or crystals | | pka | 1.22±0.10(Predicted) | | SMILES | NC1=CC(S(=O)(F)=O)=CC(C#C)=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3-Amino-5-ethynylbenzenesulfonyl fluoride >=95% Usage And Synthesis |
| Uses | 3-Amino-5-ethynylbenzenesulfonyl fluoride is used for chemical probe synthesis, this trifunctional building block contains an aryl sulfonyl fluoride group, alkyne tag, and amine synthetic handle. When appended to a ligand or pharmacophore through its amine linker, this building block allows for SuFEx-enabled, context-specific covalent modification of a biological target with potential for downstream applications via the alkyne tag. Use alone or in parallel with other multi-functional building blocks to discover the optimal probe for your chemical biology experiments. |
| | 3-Amino-5-ethynylbenzenesulfonyl fluoride >=95% Preparation Products And Raw materials |
|