- N-METHYL-P-ANISIDINE
-
- $10.00
-
2026-03-20
- CAS:5961-59-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- N-METHYL-P-ANISIDINE
-
- $1.00
-
2019-07-14
- CAS:5961-59-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | N-METHYL-P-ANISIDINE Basic information |
| | N-METHYL-P-ANISIDINE Chemical Properties |
| Melting point | 33-36 °C(lit.) | | Boiling point | 135-136 °C19 mm Hg(lit.) | | density | 1.0630 (rough estimate) | | refractive index | 1.5470 (estimate) | | Fp | >230 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in Methanol | | form | Solid | | pka | 5.55±0.12(Predicted) | | color | Yellow | | BRN | 774640 | | InChI | InChI=1S/C8H11NO/c1-9-7-3-5-8(10-2)6-4-7/h3-6,9H,1-2H3 | | InChIKey | JFXDIXYFXDOZIT-UHFFFAOYSA-N | | SMILES | C1(NC)=CC=C(OC)C=C1 | | CAS DataBase Reference | 5961-59-1(CAS DataBase Reference) | | NIST Chemistry Reference | Benzenamine, 4-methoxy-N-methyl-(5961-59-1) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 22-24/25-36/37 | | RIDADR | 2811 | | WGK Germany | 3 | | F | 10 | | HazardClass | 6.1 | | HS Code | 29222990 | | Storage Class | 11 - Combustible Solids |
| | N-METHYL-P-ANISIDINE Usage And Synthesis |
| Chemical Properties | N-METHYL-P-ANISIDINE is white to greyish-brown crystal. low melting mass | | Uses | N-METHYL-P-ANISIDINE was used to study the additive effects of amines. | | Uses | 4-Methoxy-N-methylaniline (N-Methyl-p-anisidine) was used to study the additive effects of amines. | | General Description | The allylation of N-methyl-p-anisidine by quaternary allylammonium cation was studied. |
| | N-METHYL-P-ANISIDINE Preparation Products And Raw materials |
|