|
|
| | Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate Basic information |
| Product Name: | Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate | | Synonyms: | 4-METHOXYCARBONYLPHENYLBORONIC ACID, PINACOL ESTER;4-METHOXYCARBONYLPHENYLBORONIC ACID PINACOLATE;4-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)BENZOIC ACID METHYL ESTER;2-(4-CARBOMETHOXYPHENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE;4-carbomethoxyphenylboronic acid pinacol ester;METHYL 4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZOATE;Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2;4-(Methoxycarbonyl)benzeneboronic acid pinacol ester, 97% | | CAS: | 171364-80-0 | | MF: | C14H19BO4 | | MW: | 262.11 | | EINECS: | | | Product Categories: | Aryl Boronate Esters;Boronate Esters;Boronic Acids and Derivatives;Chemical Synthesis;Organometallic Reagents;Heterocyclic Compounds;Acids and Derivatives;Boron, Nitrile, Thio,& TM-Cpds;CHIRAL CHEMICALS | | Mol File: | 171364-80-0.mol |  |
| | Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate Chemical Properties |
| Melting point | 77-81 °C(lit.) | | Boiling point | 355.6±25.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Crystalline Powder | | color | White | | InChI | InChI=1S/C14H19BO4/c1-13(2)14(3,4)19-15(18-13)11-8-6-10(7-9-11)12(16)17-5/h6-9H,1-5H3 | | InChIKey | REIZEQZILPXYKS-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(B2OC(C)(C)C(C)(C)O2)C=C1 | | CAS DataBase Reference | 171364-80-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids |
| | Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate Usage And Synthesis |
| Uses | Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate was used to prepare 2-aryl-4,4,5,5,-tetramethyl-1,3,2-dioxaborolanes via palladium-catalyzed coupling reactions. |
| | Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate Preparation Products And Raw materials |
|