| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Boric acid gel Basic information |
| Product Name: | Boric acid gel | | Synonyms: | 3-AMINOPHENYLBORONIC ACID POLYMER BOUND;Boronicacid,[3-[(2-methyl-1-oxo-2-propenyl)amino]phenyl]-,homopolymer;BORIC ACID GEL, FOR COLUMN CHROMATO-GRAP HY, 0.1-0.4 MM;Boricacidgelparticlesize0.1-0.4mmactivatedandswollen;BORIC ACID GEL, PARTICLE SIZE 0.1-0.4 MM ACTIVATED AND SWOLLEN, PURE;3-(Methacryloylamino)benzeneboronic acid copolymer;Boric acid gel,pure,particle size 0.1-0.4 mmactivated and swollen;Boric acid gel 0.1-0.4 mm particle size | | CAS: | 41685-84-1 | | MF: | C10H12BNO3 | | MW: | 205.02 | | EINECS: | | | Product Categories: | | | Mol File: | 41685-84-1.mol |  |
| | Boric acid gel Chemical Properties |
| density | 0.6 g/mL at 25 °C(lit.) | | form | powder | | InChI | 1S/C10H12BNO3/c1-7(2)10(13)12-9-5-3-4-8(6-9)11(14)15/h3-6,14-15H,1H2,2H3,(H,12,13) | | InChIKey | GBBUBIKYAQLESK-UHFFFAOYSA-N | | SMILES | CC(=C)C(=O)Nc1cccc(c1)B(O)O |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 28100090 | | Storage Class | 11 - Combustible Solids |
| | Boric acid gel Usage And Synthesis |
| Chemical Properties | off-white to pale orange beads | | Uses | Useful to capture avidin for boron-neutron capture therapy applications | | reaction suitability | reaction type: solution phase peptide synthesis
reactivity: alcohol reactive |
| | Boric acid gel Preparation Products And Raw materials |
|