|
|
| | 3,4-Diethoxyphenylacetic acid Basic information |
| Product Name: | 3,4-Diethoxyphenylacetic acid | | Synonyms: | ART-CHEM-BB B006522;3,4-diethoxybenzeneacetic acid;3,4-Diethyloxy;2-(3,4-diethoxyphenyl)ethanoic acid;2-(3,4-BIS(HYDROXYMETHYL)PHENYL)ACETIC ACID;(3,4-diethoxyphenyl)acetic acid(SALTDATA: FREE);RARECHEM AL BO 0610;VITAS-BB TBB000357 | | CAS: | 38464-04-9 | | MF: | C12H16O4 | | MW: | 224.25 | | EINECS: | 253-957-3 | | Product Categories: | Acetics acid and esters | | Mol File: | 38464-04-9.mol |  |
| | 3,4-Diethoxyphenylacetic acid Chemical Properties |
| Melting point | 77-79°C | | Boiling point | 357.2±27.0 °C(Predicted) | | density | 1.133±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 4.36±0.10(Predicted) | | color | White to Orange to Green | | InChI | InChI=1S/C12H16O4/c1-3-15-10-6-5-9(8-12(13)14)7-11(10)16-4-2/h5-7H,3-4,8H2,1-2H3,(H,13,14) | | InChIKey | FIKUHWAANCXBGJ-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC=C(OCC)C(OCC)=C1 | | CAS DataBase Reference | 38464-04-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | HS Code | 2918.99.4700 | | HazardClass | IRRITANT |
| | 3,4-Diethoxyphenylacetic acid Usage And Synthesis |
| Synthesis |
0.8 g of 3,4-dihydroxy-phenylacetic acid and 6.9 g of barium hydroxide octahydrate are dissolved in 50 ml of water and at ambient temperature 2.9 ml of diethylsulphate are added dropwise.. The solution is stirred for 2 hours at ambient temperature and for 2 hours at 40° C. After this time, the solution is acidified with saturated potassium hydrogen sulphate solution, mixed with ethyl acetate and the suspension is filtered through Celite. The phases are separated, and the ethyl acetate phase is dried over sodium sulphate and concentrated by evaporation. The residue obtained from 3,4-Diethoxyphenylacetic acid is purified through a silica gel column with toluene/ethyl acetate/ethanol (4:2:1) as eluant.
|
| | 3,4-Diethoxyphenylacetic acid Preparation Products And Raw materials |
|