|
|
| | Tetrapropylammonium hydroxide Basic information |
| Product Name: | Tetrapropylammonium hydroxide | | Synonyms: | TETRAPROPYLAMMONIUM HYDROXIDE;TETRA-N-PROPYLAMMONIUM HYDROXIDE;Tetrapropylammonium hydroxide solution,25% in Water;Tetrapropylammonium hydroxide solution,40% in Water;TETRAPROPYLAMMONIUM HYDROXIDE, 1 M, AQUEOUS SOLUTIONTETRAPROPYLAMMONIUM HYDROXIDE, 1 M, AQUEOUS SOLUTIONTETRAPROPYLAMMONIUM HYDROXIDE, 1 M, AQUEOUS SOLUTIONTETRAPROPYLAMMONIUM HYDROXIDE, 1 M, AQUEOUS SOLUTION;Tetrapropylammonium bydroxide;TETRAPROPYLAMMONIUM HYDROXIDE SOLUTION, ~20% IN WATER;TETRAPROPYLAMMONIUM HYDROXIDE, 1.0M SOLU TION IN WATER | | CAS: | 4499-86-9 | | MF: | C12H29NO | | MW: | 203.37 | | EINECS: | 224-800-6 | | Product Categories: | Chemical Synthesis;Organic Bases;Synthetic Reagents;Ammonium Hydroxides (Quaternary);Quaternary Ammonium Compounds;quarternary ammonium bases | | Mol File: | 4499-86-9.mol |  |
| | Tetrapropylammonium hydroxide Chemical Properties |
| Boiling point | 100-102 °C | | density | 1.00 g/mL at 20 °C | | refractive index | n20/D 1.370 | | Fp | 102°C | | storage temp. | Store below +30°C. | | solubility | Miscible with strong electrolytes. | | form | Liquid | | Specific Gravity | 1.012 | | color | Clear colorless | | PH Range | 14 | | PH | >7 (H2O, 20°C) (undiluted) | | Water Solubility | Miscible in water | | Sensitive | Air Sensitive | | BRN | 4207983 | | InChI | 1S/C12H28N.H2O/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H2/q+1;/p-1 | | InChIKey | LPSKDVINWQNWFE-UHFFFAOYSA-M | | SMILES | [OH-].CCC[N+](CCC)(CCC)CCC | | CAS DataBase Reference | 4499-86-9(CAS DataBase Reference) | | EPA Substance Registry System | 1-Propanaminium, N,N,N-tripropyl-, hydroxide (4499-86-9) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3267 8/PG 3 | | WGK Germany | 3 | | RTECS | BS8400000 | | F | 4.4-10-34 | | TSCA | TSCA listed | | HS Code | 2923 90 00 | | HazardClass | 8 | | PackingGroup | II | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Tetrapropylammonium hydroxide Usage And Synthesis |
| Chemical Properties | clear colorless solution | | Uses | Tetra-n-propylammonium hydroxide is used as an intermediate, ion exchange agent, surface-active agent and solvent. Further, it is used as an antistatic agent, detergent sanitizers, softener for textiles and paper products, emulsifying agents and pigment dispersers. It finds application as curing accelerators. In addition to this, it acts as a phase transfer catalyst in organic synthesis to enhance the reaction rate. | | General Description | Tetrapropylammonium hydroxide, a quaternary ammonium compound, is mainly used as a structure directing agent for the preparation of molecular sieves and zeolites. |
| | Tetrapropylammonium hydroxide Preparation Products And Raw materials |
|