|
|
| | Ethyl 4,4-difluoro-3-oxobutanoate Basic information |
| Product Name: | Ethyl 4,4-difluoro-3-oxobutanoate | | Synonyms: | AKOS MSC-0700;AKOS B016254;ETHYL 4,4-DIFLUORO-3-OXOBUTYRATE;ETHYL 4,4-DIFLUOROACETOACETATE;ART-CHEM-BB B016254;Difluoro aceto acetat;Ethyl 4,4-difluoro-3-oxobutyrate 90%;Ethyl4,4-difluoro-3-oxobutyrate90% | | CAS: | 352-24-9 | | MF: | C6H8F2O3 | | MW: | 166.12 | | EINECS: | 206-519-0 | | Product Categories: | top | | Mol File: | 352-24-9.mol |  |
| | Ethyl 4,4-difluoro-3-oxobutanoate Chemical Properties |
| Melting point | -46°C(lit.) | | Boiling point | 162 °C | | density | 1,61 g/cm3 | | refractive index | 1.407 | | Fp | 68℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 8.61±0.46(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C6H8F2O3/c1-2-11-5(10)3-4(9)6(7)8/h6H,2-3H2,1H3 | | InChIKey | CBDPWKVOPADMJC-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CC(=O)C(F)F | | CAS DataBase Reference | 352-24-9(CAS DataBase Reference) | | EPA Substance Registry System | Ethyl 4,4-difluoroacetoacetate (352-24-9) |
| Hazard Codes | F,Xi | | Risk Statements | 10-36/37/38-36/38 | | Safety Statements | 26-36/37/39 | | RIDADR | 1993 | | WGK Germany | 3 | | Hazard Note | Flammable | | TSCA | TSCA listed | | HazardClass | IRRITANT, FLAMMABLE | | HazardClass | 3 | | HS Code | 2918300090 |
| | Ethyl 4,4-difluoro-3-oxobutanoate Usage And Synthesis |
| Uses | Ethyl 4,4-difluoro-3-oxobutanoate is an intermediate used for the synthesis of pharmaceuticals such as potassium channel activators and β-alanine derived GABA-T antagonists. | | Uses | Ethyl 4,4-Difluoroacetoacetate is an intermediate used for the synthesis of pharmaceuticals such as potassium channel activators and β-alanine derived GABA-T antagonists. |
| | Ethyl 4,4-difluoro-3-oxobutanoate Preparation Products And Raw materials |
|