|
|
| | OTAVA-BB BB7020402297 Basic information |
| Product Name: | OTAVA-BB BB7020402297 | | Synonyms: | OTAVA-BB BB7020402297;Ethyl 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylate;2-(4-Fluoro-phenyl)-4-methyl-thiazole-5-carboxylic acid ethyl ester;5-Thiazolecarboxylic acid, 2-(4-fluorophenyl)-4-methyl-, ethyl ester | | CAS: | 317319-17-8 | | MF: | C13H12FNO2S | | MW: | 265.3 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | OTAVA-BB BB7020402297 Chemical Properties |
| Melting point | 57-60°C | | storage temp. | Store at room temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C13H12FNO2S/c1-3-17-13(16)11-8(2)15-12(18-11)9-4-6-10(14)7-5-9/h4-7H,3H2,1-2H3 | | InChIKey | JSUXMRIOSHOTNY-UHFFFAOYSA-N | | SMILES | Fc1ccc(cc1)c2[s]c(c(n2)C)C(=O)OCC |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | OTAVA-BB BB7020402297 Usage And Synthesis |
| | OTAVA-BB BB7020402297 Preparation Products And Raw materials |
|