|
|
| | 2,4-DIAMINO-1,3,5-TRIAZINE Basic information |
| Product Name: | 2,4-DIAMINO-1,3,5-TRIAZINE | | Synonyms: | TIMTEC-BB SBB007570;2,4-DIAMINO-1,3,5-TRIAZINE;2,4-DIAMINO-S-TRIAZINE;1,3,5-TRIAZINE-2,4-DIAMINE;formoguanamine;Ametryn Impurity 1 (2,4-Diamino-1,3,5-Triazine);Diaminotriazine;2,4-DIAMINO-1,3,5-TRIAZINE 98% | | CAS: | 504-08-5 | | MF: | C3H5N5 | | MW: | 111.11 | | EINECS: | 207-983-7 | | Product Categories: | Miscellaneous;Fluorenes, etc. (reagent for high-performance polymer research);Functional Materials;Reagent for High-Performance Polymer Research | | Mol File: | 504-08-5.mol |  |
| | 2,4-DIAMINO-1,3,5-TRIAZINE Chemical Properties |
| Melting point | >300°C | | Boiling point | 447.6±28.0 °C(Predicted) | | density | 1.508±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 4.24±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C3H5N5/c4-2-6-1-7-3(5)8-2/h1H,(H4,4,5,6,7,8) | | InChIKey | VZXTWGWHSMCWGA-UHFFFAOYSA-N | | SMILES | N1=CN=C(N)N=C1N | | CAS DataBase Reference | 504-08-5(CAS DataBase Reference) | | EPA Substance Registry System | 1,3,5-Triazine-2,4-diamine (504-08-5) |
| Provider | Language |
|
ALFA
| English |
| | 2,4-DIAMINO-1,3,5-TRIAZINE Usage And Synthesis |
| Uses | 2,4-Diamino-1,3,5-triazine is a reactant or reagent that has numerous uses. A triazine-modified dendrimer G5-DAT66 was synthesized and used as a vector for osteosarcoma TRAIL gene therapy in vitro and in vivo. 2,4-Diamino-1,3,5-triazine was also used to synthesize water soluble copper(II)-dipeptide complexes which exhibited considerable in vitro cytotoxicity against four human carcinoma cell lines (HepG2, HeLa, A549 and U87). These water soluble DNA minor groove binding diamino-s-triazine copper based complexes are potential chemotherapeutic agents. | | Definition | ChEBI: 1,3,5-triazine-2,4-diamine is a diamino-1,3,5-triazine. |
| | 2,4-DIAMINO-1,3,5-TRIAZINE Preparation Products And Raw materials |
|