|
|
| | L-(+)-MANDELIC ACID ETHYL ESTER Basic information |
| | L-(+)-MANDELIC ACID ETHYL ESTER Chemical Properties |
| Melting point | 32-34 °C(lit.) | | Boiling point | 106-107 °C4 mm Hg(lit.) | | density | 1.12 | | refractive index | 1.5392 (estimate) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | pka | 12.33±0.20(Predicted) | | form | powder to lump to clear liquid | | color | White or Colorless to Light yellow | | Optical Rotation | [α]21/D +134°, c = 3 in chloroform | | FreezingPoint | 27.0 to 30.0 ℃ | | InChI | 1S/C10H12O3/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9,11H,2H2,1H3/t9-/m0/s1 | | InChIKey | SAXHIDRUJXPDOD-VIFPVBQESA-N | | SMILES | CCOC(=O)[C@@H](O)c1ccccc1 | | CAS DataBase Reference | 13704-09-1(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2918199890 | | Storage Class | 11 - Combustible Solids |
| | L-(+)-MANDELIC ACID ETHYL ESTER Usage And Synthesis |
| Uses | Ethyl (S)-(+)-mandelate can be used as a starting material for the preparation of N-benzyl 2-phenylacetamide derivatives, which are known as potent anticonvulsant agents. | | Definition | ChEBI: Ethyl (2S)-hydroxy(phenyl)acetate is the (2S)-enantiomer of ethyl hydroxy(phenyl)acetate. It is an enantiomer of an ethyl (2R)-hydroxy(phenyl)acetate. |
| | L-(+)-MANDELIC ACID ETHYL ESTER Preparation Products And Raw materials |
|