| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
|
| | Guanosine 5'-monophosphomorpholidate 4-morpholine-N,N'-dicyclohexylcarboxamidine salt Basic information |
| Product Name: | Guanosine 5'-monophosphomorpholidate 4-morpholine-N,N'-dicyclohexylcarboxamidine salt | | Synonyms: | guanosine 5'-monophosphomorpholidate;guanosine 5'-monophosphomorpholidate, MDCC salt;Guanosine 5'-monophosphomorpholidate 4-morpholine-N,N'-dicyclohexylcarboxamidine salt ~95%;guanosine 5’-monophosphomorpholidate N,N’-dicyclohexylmorpholine-4-carboxamidine salt;(Z)-N,N'-dicyclohexylmorpholine-4-carboximidamide rac-((2R,3S,4R,5R)-5-(2-amino-6-oxo-1,6-dihydro-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl morpholinophosphonate;Guanosine 5'-monophosphomorpholidate 4-morpholine-N,N'-dicyclohexylcarboxamidine salt | | CAS: | 7361-07-1 | | MF: | C17H31N3O.C14H21N6O8P | | MW: | 725.77 | | EINECS: | | | Product Categories: | Biochemicals and Reagents;Nucleosides, Nucleotides, Oligonucleotides;Nucleotide Analogs | | Mol File: | 7361-07-1.mol |  |
| | Guanosine 5'-monophosphomorpholidate 4-morpholine-N,N'-dicyclohexylcarboxamidine salt Chemical Properties |
| storage temp. | -20°C | | solubility | water: 50 mg/mL, clear, colorless to light yellow | | form | powder | | biological source | synthetic (organic) | | Water Solubility | water: 50mg/mL, clear, colorless to light yellow | | InChIKey | CFNWUGDJWKRMBL-VAMAKUSHSA-N | | SMILES | C1CCC(CC1)N\C(=N\C2CCCCC2)N3CCOCC3.NC4=NC(=O)c5ncn([C@@H]6O[C@H](COP(O)(=O)N7CCOCC7)[C@@H](O)[C@H]6O)c5N4 |
| Hazard Codes | T | | Risk Statements | 23/24/25-36/37/38-25 | | Safety Statements | 22-26-36-45 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Guanosine 5'-monophosphomorpholidate 4-morpholine-N,N'-dicyclohexylcarboxamidine salt Usage And Synthesis |
| Uses | Guanosine 5′-monophosphomorpholidate may be used to synthesize guanosine diphosphate sugars such as GDP-fucose, GDP-mannose, UDP-galactose, and other more complex sugars nucleotides. |
| | Guanosine 5'-monophosphomorpholidate 4-morpholine-N,N'-dicyclohexylcarboxamidine salt Preparation Products And Raw materials |
|