|
|
| | 4-CHLORO-3,5-DINITROBENZONITRILE Basic information |
| | 4-CHLORO-3,5-DINITROBENZONITRILE Chemical Properties |
| Melting point | 140.5-141 °C (lit.) | | Boiling point | 326.3±42.0 °C(Predicted) | | density | 2.0705 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), DMSO | | form | Solid | | color | Light Yellow to Yellow | | Water Solubility | Insoluble in water. | | BRN | 1990451 | | Stability: | Unstable in Solution | | InChI | 1S/C7H2ClN3O4/c8-7-5(10(12)13)1-4(3-9)2-6(7)11(14)15/h1-2H | | InChIKey | SCGDEDHSPCXGEC-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cc(cc(c1Cl)[N+]([O-])=O)C#N | | CAS DataBase Reference | 1930-72-9(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | 3439 | | WGK Germany | 3 | | RTECS | DI2990000 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | | Toxicity | mouse,LD50,intraperitoneal,50mg/kg (50mg/kg),Farmaco, Edizione Scientifica. Vol. 41, Pg. 41, 1986. |
| | 4-CHLORO-3,5-DINITROBENZONITRILE Usage And Synthesis |
| Chemical Properties | YELLOW CRYSTALLINE POWDER | | Uses | 4-Chloro-3,5-dinitrobenzonitrile is may be used in the synthesis of 3-nitro-4-thiocyanobenzonitryl. It is also used as Pharmaceutical intermediates . |
| | 4-CHLORO-3,5-DINITROBENZONITRILE Preparation Products And Raw materials |
|