| Company Name: |
Hu Bei Jiutian Bio-medical Technology CO.,Ltd |
| Tel: |
027-88013699 17354350817 |
| Email: |
Ryan@jiutian-bio.com |
| Products Intro: |
Product Name:Bicyclo[2.2.1]heptane-1-methanesulfonicacid, 7,7-dimethyl-2-oxo-, ammonium salt (1:1), (1R,4S)-
CAS:82509-30-6
Purity:0.99 Package:25kg,50kg,180kg,200kg,250kg,1000kg,as your needs Remarks:as your needs
|
|
|
|
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(1R)-(?)-10-CaMphorsulfonic acid aMMoniuM salt
CAS:82509-30-6
Package:50G
|
(1R)-(-)-10-CAMPHORSULFONIC ACID, AMMONIUM SALT manufacturers
|
| | (1R)-(-)-10-CAMPHORSULFONIC ACID, AMMONIUM SALT Basic information |
| Product Name: | (1R)-(-)-10-CAMPHORSULFONIC ACID, AMMONIUM SALT | | Synonyms: | (1R)-(-)-10-CAMPHORSULFONIC ACID, AMMONIUM SALT;(1r)-(-)-10-camphorsulfonic;ammonium (1R)-[7,7-dimethyl-2-oxobicyclo[2.2.1]hept-1-yl]methanesulphonate;(1R,4S)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptane-1α-methanesulfonic acid ammonium salt;Einecs 279-985-6;(1R)-(-)-10-Camphorsulfonic acid ammonium salt >=97.0% (T);(1R)-(-)-10-Camphorsulfonic acid ammonium salt 98%;Bicyclo[2.2.1]heptane-1-methanesulfonicacid, 7,7-dimethyl-2-oxo-, ammonium salt (1:1), (1R,4S)- | | CAS: | 82509-30-6 | | MF: | C10H19NO4S | | MW: | 249.33 | | EINECS: | 279-985-6 | | Product Categories: | Chiral Building Blocks;Organic Building Blocks;Sulfonic/Sulfinic Acid Salts | | Mol File: | 82509-30-6.mol |  |
| | (1R)-(-)-10-CAMPHORSULFONIC ACID, AMMONIUM SALT Chemical Properties |
| Melting point | 250 °C (dec.) (lit.) | | form | solid | | Optical Rotation | [α]22/D 18.4°, c = 5.3 in H2O | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChI | 1S/C10H16O4S.H3N/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;/h7H,3-6H2,1-2H3,(H,12,13,14);1H3/t7-,10-;/m0./s1 | | InChIKey | JTMZBRWRXFAITF-YUWZRIFDSA-N | | SMILES | N.CC1(C)[C@H]2CC[C@]1(CS(O)(=O)=O)C(=O)C2 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (1R)-(-)-10-CAMPHORSULFONIC ACID, AMMONIUM SALT Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses | Reactant involved in the synthesis of chiral anionic liquids for use as solvents and chiral shift reagents | | General Description | (1R)-(-)-10-Camphorsulfonic acid ammonium salt may be used as an ion-pair reagent to enhance the ability of supercritical carbon dioxide to extract polar compounds in supercritical fluid extraction (SFE) process. It can also be used in the synthesis of (-)-quadrone. |
| | (1R)-(-)-10-CAMPHORSULFONIC ACID, AMMONIUM SALT Preparation Products And Raw materials |
|