|
| ethyl cyclopent-3-ene-1-carboxylate Basic information |
Product Name: | ethyl cyclopent-3-ene-1-carboxylate | Synonyms: | ETHYL 3-CYCLOPENTENECARBOXYLATE;2-ethyl-1-cyclopent-3-enecarboxylic acid;3-CYCLOPENTENECARBOXYLIC ACID ETHYL ESTER;ethyl cyclopent-3-enecarboxylate;3-cyclopentene-1-carhoxylic acid ethyl ester;ETHYL 3-CYCLOPENTENE-1-CARBOXYLATE;3-Cyclopentene-1-carboxylic acid ethyl ester;Ethyl 3-cyclopentenecarboxylic acid | CAS: | 21622-01-5 | MF: | C8H12O2 | MW: | 140.18 | EINECS: | | Product Categories: | INTERMEDIATESOFDOLASETRONMESYLATE | Mol File: | 21622-01-5.mol |  |
| ethyl cyclopent-3-ene-1-carboxylate Chemical Properties |
Boiling point | 64°C/15mmHg(lit.) | density | 1.029±0.06 g/cm3(Predicted) | refractive index | 1.4460-1.4500 | storage temp. | Storage temp. 2-8°C | form | clear liquid | color | Colorless to Almost colorless | InChI | InChI=1S/C8H12O2/c1-2-10-8(9)7-5-3-4-6-7/h3-4,7H,2,5-6H2,1H3 | InChIKey | CTLAIKSGNQPPLO-UHFFFAOYSA-N | SMILES | C1(C(OCC)=O)CC=CC1 | CAS DataBase Reference | 21622-01-5(CAS DataBase Reference) |
RIDADR | 3272 | HazardClass | 3 | PackingGroup | III | HS Code | 29161900 |
| ethyl cyclopent-3-ene-1-carboxylate Usage And Synthesis |
| ethyl cyclopent-3-ene-1-carboxylate Preparation Products And Raw materials |
|