| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 3-Aminopyrazole-4-carboxylic acid Basic information |
| | 3-Aminopyrazole-4-carboxylic acid Chemical Properties |
| Melting point | 135 °C (dec.) (lit.) | | Boiling point | 235.85°C (rough estimate) | | density | 1.4748 (rough estimate) | | refractive index | 1.5000 (estimate) | | storage temp. | 2-8°C | | form | powder | | pka | 15.28±0.50(Predicted) | | color | White | | InChI | InChI=1S/C4H5N3O2/c5-3-2(4(8)9)1-6-7-3/h1H,(H,8,9)(H3,5,6,7) | | InChIKey | KMRVTZLKQPFHFS-UHFFFAOYSA-N | | SMILES | N1C=C(C(O)=O)C(N)=N1 | | CAS DataBase Reference | 41680-34-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | UQ6390000 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-Aminopyrazole-4-carboxylic acid Usage And Synthesis |
| Chemical Properties | Almost white to beige crystalline powder | | Uses | 3-Amino-1H-pyrazole-4-carboxylic Acid, is a heterocyclic building block used for the synthesis of more complex pharmaceutical and biologically active compounds, including inhibitors. It can be used for the preparation of some impurities and/or degradation products of Zaleplon (Z145000), and also for Arylsulfonamidopiperidone derivatives as a novel class of factor Xa inhibitors. |
| | 3-Aminopyrazole-4-carboxylic acid Preparation Products And Raw materials |
|