|
|
| | METHYL GREEN Basic information |
| Product Name: | METHYL GREEN | | Synonyms: | Ammonium,[.alpha.-[p-(dimethylamino)phenyl]-.alpha.-[4-(dimethyliminio)-2,5-cyclohexadien-1-ylidene]-p-tolyl)ethyldimethyl-,bromide,chloride;benzenaminium,4-[[4-(dimethylamino)phenyl][4-(dimethyliminio)-2,5-cyclohexadie;ETHYL GREEN;C.I. 42590;n-dimethyl-n-1-ylidene]methyl]-n-ethyl-bromidechloride;Ammonium, [α-[p-(dimethylamino)phenyl]-α-[4-(dimethyliminio)-2,5-cyclohexa-dien-1-ylidene]-p-tolyl]-ethyldimethyl-, bromide, chloride;[α-[p-(dimethylamino)-phenyl]- Aα-[4-(methylimino)-2,5-cyclohexadien-1-ylidene]-p-tolyl]ethyldimethylammonium bromide,methochloride;METHYLGREENSOLUTION,0.1%AQUEOUSSOLUTION;METHYL GREEN 23S | | CAS: | 14855-76-6 | | MF: | C27H35BrClN3 | | MW: | 516.94 | | EINECS: | 238-920-1 | | Product Categories: | Triphenylmethane | | Mol File: | 14855-76-6.mol |  |
| | METHYL GREEN Chemical Properties |
| Melting point | >300°C | | solubility | Solubility Soluble in water, ethanol; insoluble in xylene | | form | Liquid | | color | Green | | PH Range | Yellow (0.1) to Greenish-blue (2.3) | | λmax | 635nm, 420nm | | Major Application | Inks, nucleic acid stain, antifungal agent | | InChI | InChI=1S/C26H33N3.2ClH/c1-27(2)23-14-8-20(9-15-23)26(21-10-16-24(17-11-21)28(3)4)22-12-18-25(19-13-22)29(5,6)7;;/h8-19H,1-7H3;2*1H/q+2;;/p-2 | | InChIKey | DWCZIOOZPIDHAB-UHFFFAOYSA-L | | SMILES | C(=C1C=CC(=[N+](C)C)C=C1)(C1C=CC(N(C)C)=CC=1)C1C=CC([N+](C)(C)C)=CC=1.[Cl-].[Cl-] |c:0,t:4| | | EPA Substance Registry System | Benzenaminium, 4-[[4-(dimethylamino)phenyl][4-(dimethyliminio)-2,5-cyclohexadien-1-ylidene]methyl]-N-ethyl-N,N-dimethyl-, bromide chloride (14855-76-6) |
| | METHYL GREEN Usage And Synthesis |
| Uses | Dyeing and printing textiles; as biological stain. | | Definition | ChEBI: An iminium salt composed of [4-([4-(dimethylamino)phenyl]{4-[ethyl(dimethyl)azaniumyl]phenyl}methylidene)cyclohexa-2,5-dien-1-ylidene](dimethyl)ammonium, bromide and chloride ions in a 1:1:1 ratio. A histological dye used to demonstrate nucleic acids by th
Unna-Pappenheim stain, in conjunction with Pyronin Y. |
| | METHYL GREEN Preparation Products And Raw materials |
|