(S)-2-(3,4,5-TRIMETHOXYPHENYL)BUTYRIC ACID manufacturers
|
| (S)-2-(3,4,5-TRIMETHOXYPHENYL)BUTYRIC ACID Basic information |
Product Name: | (S)-2-(3,4,5-TRIMETHOXYPHENYL)BUTYRIC ACID | Synonyms: | (S)-2-(3,4,5-Trimethoxyphenyl)butanoic acid;(2S)-2-(3,4,5-Trimethoxyphenyl)butanoic acid;(2S)-2-(3,4,5-Trimethoxyphenyl)butyric acid;Benzeneacetic acid, a-ethyl-3,4,5-triMethoxy-, (aS)-;(S)-2-(3,4,5-TRIMETHOXYPHENYL)BUTYRIC ACID;(2S)-2-(3,4,5-Trimethoxyphenyl)butanoic acid 98%;(2S)-2-(3,4,5-trimethoxyphenyl)butanoate;Benzeneacetic acid, α-ethyl-3,4,5-trimethoxy-, (αS)- | CAS: | 195202-08-5 | MF: | C13H18O5 | MW: | 254.28 | EINECS: | | Product Categories: | | Mol File: | 195202-08-5.mol |  |
| (S)-2-(3,4,5-TRIMETHOXYPHENYL)BUTYRIC ACID Chemical Properties |
Melting point | 86-89°C | Boiling point | 378.9±42.0 °C(Predicted) | density | 1.142±0.06 g/cm3(Predicted) | storage temp. | Sealed in dry,Room Temperature | solubility | DMSO (Slightly), methanol (Sparingly) | pka | 4.28±0.14(Predicted) | form | Solid | color | White to Off-White | InChI | InChI=1/C13H18O5/c1-5-9(13(14)15)8-6-10(16-2)12(18-4)11(7-8)17-3/h6-7,9H,5H2,1-4H3,(H,14,15)/t9-/s3 | InChIKey | WBULUDGUWZFLMO-DJEYLCQNNA-N | SMILES | C1=C(C(OC)=C(C=C1[C@H](CC)C(=O)O)OC)OC |&1:8,r| |
Hazard Codes | Xi | HS Code | 2915601990 |
| (S)-2-(3,4,5-TRIMETHOXYPHENYL)BUTYRIC ACID Usage And Synthesis |
Uses | (S)-2-(3,4,5-Trimethoxyphenyl)butyric Acid, is a building block used in various chemical synthesis. | References | [1] Patent: WO2012/103279, 2012, A2. Location in patent: Page/Page column 11-12 |
| (S)-2-(3,4,5-TRIMETHOXYPHENYL)BUTYRIC ACID Preparation Products And Raw materials |
|