(S)-2-(3,4,5-Trimethoxyphenyl)butyric acid manufacturers
|
| | (S)-2-(3,4,5-Trimethoxyphenyl)butyric acid Basic information |
| Product Name: | (S)-2-(3,4,5-Trimethoxyphenyl)butyric acid | | Synonyms: | (S)-2-(3,4,5-Trimethoxyphenyl)butanoic acid;(2S)-2-(3,4,5-Trimethoxyphenyl)butanoic acid;(2S)-2-(3,4,5-Trimethoxyphenyl)butyric acid;Benzeneacetic acid, a-ethyl-3,4,5-triMethoxy-, (aS)-;(2S)-2-(3,4,5-Trimethoxyphenyl)butanoic acid 98%;(2S)-2-(3,4,5-trimethoxyphenyl)butanoate;Benzeneacetic acid, α-ethyl-3,4,5-trimethoxy-, (αS)-;(S)-2-(3,4,5-Trimethoxyphenyl)butyric acid | | CAS: | 195202-08-5 | | MF: | C13H18O5 | | MW: | 254.28 | | EINECS: | | | Product Categories: | | | Mol File: | 195202-08-5.mol |  |
| | (S)-2-(3,4,5-Trimethoxyphenyl)butyric acid Chemical Properties |
| Melting point | 86-89°C | | Boiling point | 378.9±42.0 °C(Predicted) | | density | 1.142±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), methanol (Sparingly) | | pka | 4.28±0.14(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1/C13H18O5/c1-5-9(13(14)15)8-6-10(16-2)12(18-4)11(7-8)17-3/h6-7,9H,5H2,1-4H3,(H,14,15)/t9-/s3 | | InChIKey | WBULUDGUWZFLMO-DJEYLCQNNA-N | | SMILES | C1=C(C(OC)=C(C=C1[C@H](CC)C(=O)O)OC)OC |&1:8,r| |
| Hazard Codes | Xi | | HS Code | 2915601990 |
| | (S)-2-(3,4,5-Trimethoxyphenyl)butyric acid Usage And Synthesis |
| Uses | (S)-2-(3,4,5-Trimethoxyphenyl)butyric Acid, is a building block used in various chemical synthesis. | | References | [1] Patent: WO2012/103279, 2012, A2. Location in patent: Page/Page column 11-12 |
| | (S)-2-(3,4,5-Trimethoxyphenyl)butyric acid Preparation Products And Raw materials |
|