|
|
| | 4',5,7-TRIMETHOXYFLAVONE Basic information |
| Product Name: | 4',5,7-TRIMETHOXYFLAVONE | | Synonyms: | 4',5,7- Trimethoxyflarone;4',5,7-TRIMETHOXYFLAVONE;5,7,4'-trimethylapigenin;APIGENIN TRIMETHYL ETHER;5,7,4'-TRIMETHOXYFLAVONE;2-(4-Methoxyphenyl)-5,7-dimethoxy-4H-1-benzopyran-4-one;Trimethylapigenin;Tri-O-methylapigenin | | CAS: | 5631-70-9 | | MF: | C18H16O5 | | MW: | 312.32 | | EINECS: | | | Product Categories: | Tri-substituted Flavones | | Mol File: | 5631-70-9.mol |  |
| | 4',5,7-TRIMETHOXYFLAVONE Chemical Properties |
| Melting point | 158-160°C (dec.) | | Boiling point | 506.5±50.0 °C(Predicted) | | density | 1.242±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | form | Solid | | color | Light yellow to yellow | | InChI | InChI=1S/C18H16O5/c1-20-12-6-4-11(5-7-12)15-10-14(19)18-16(22-3)8-13(21-2)9-17(18)23-15/h4-10H,1-3H3 | | InChIKey | ZXJJBDHPUHUUHD-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(OC)C=C2)OC2=CC(OC)=CC(OC)=C2C(=O)C=1 | | LogP | 3.530 (est) |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4',5,7-TRIMETHOXYFLAVONE Usage And Synthesis |
| Uses | 4'',5,7-Trimethoxyflavone is significantly effective at inhibiting proliferation of SNU-16 human gastric cancer cells in a concentration dependent manner. | | Definition | ChEBI: 4',5,7-Trimethoxyflavone is an ether and a member of flavonoids. | | IC 50 | Caspase-3; PARP |
| | 4',5,7-TRIMETHOXYFLAVONE Preparation Products And Raw materials |
|