2-(4-BIPHENYLYL)-2-PROPANOL manufacturers
|
| | 2-(4-BIPHENYLYL)-2-PROPANOL Basic information |
| | 2-(4-BIPHENYLYL)-2-PROPANOL Chemical Properties |
| Melting point | 88-92 °C | | Boiling point | 122-124 °C(Press: 3 Torr) | | density | 1.048±0.06 g/cm3(Predicted) | | solubility | chloroform: soluble1g/10 mL, clear, colorless | | pka | 14.40±0.29(Predicted) | | form | powder | | BRN | 1947575 | | InChI | 1S/C15H16O/c1-15(2,16)14-10-8-13(9-11-14)12-6-4-3-5-7-12/h3-11,16H,1-2H3 | | InChIKey | GOKGIYHIVSGXDM-UHFFFAOYSA-N | | SMILES | CC(C)(O)c1ccc(cc1)-c2ccccc2 | | EPA Substance Registry System | [1,1'-Biphenyl]-4-methanol, .alpha.,.alpha.-dimethyl- (34352-74-4) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed |
| | 2-(4-BIPHENYLYL)-2-PROPANOL Usage And Synthesis |
| Uses | 2-(4-Biphenylyl)-2-propanol on oxidation by graphite oxide (effcient oxidizing agent) yields 4-(prop-1-en-2-yl)-1,1′-biphenyl. It is converted into corresponding alkyl thiocyanate by using 2-chloro-1-methylpyridinium iodide (Mukaiyama reagent) in acetonitrile. | | General Description | 2-(4-Biphenylyl)-2-propanol on oxidation by graphite oxide (effcient oxidizing agent) yields 4-(prop-1-en-2-yl)-1,1′-biphenyl. It is converted into corresponding alkyl thiocyanate by using 2-chloro-1-methylpyridinium iodide (Mukaiyama reagent) in acetonitrile. |
| | 2-(4-BIPHENYLYL)-2-PROPANOL Preparation Products And Raw materials |
|