| Company Name: |
Angel Pharmaceuticals Co., Ltd. Gold
|
| Tel: |
17305837352; 17305837352 |
| Email: |
3900906393@qq.com |
| Products Intro: |
Product Name:2β-trans-eldecalcitol
CAS:861996-34-1
Purity:＞90% Package:10mg;100mg;500mg
|
2β-trans-eldecalcitol manufacturers
|
| | 2β-trans-eldecalcitol Basic information |
| Product Name: | 2β-trans-eldecalcitol | | Synonyms: | 2β-trans-eldecalcitol;Eldecalcitol Impurity 1;2β-trans-eldecalcito;(5E,7E)-(1R,2R,3R)-2-(3-hydroxypropoxy)-9,10-secocholesta-5,7,10(19)-triene-1,3,25-triol;2α-trans-Eldecalcitol;(1R,2R,3R,E)-5-(2-((1R,3aS,7aR,E)-1-((R)-6-hydroxy-6-methylheptan-2-yl)-7a-methyloctahydro-4H-inden-4-ylidene)ethylidene)-2-(3-hydroxypropoxy)-4-methylenecyclohexane-1,3-diol;9,10-Secocholesta-5,7,10(19)-triene-1,3,25-triol, 2-(3-hydroxypropoxy)-, (1α,2β,3β,5E,7E)- (9CI);Trans ED-71 | | CAS: | 861996-34-1 | | MF: | C30H50O5 | | MW: | 490.715 | | EINECS: | | | Product Categories: | | | Mol File: | 861996-34-1.mol |  |
| | 2β-trans-eldecalcitol Chemical Properties |
| Boiling point | 655.7±55.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | pka | 13.80±0.60(Predicted) | | InChIKey | FZEXGDDBXLBRTD-GPSOBGKZNA-N | | SMILES | [C@@H]1(O)C/C(=C\C=C2/CCC[C@@]3(C)[C@@]/2([H])CC[C@@H]3[C@@H](CCCC(O)(C)C)C)/C(=C)[C@@H](O)[C@@H]1OCCCO |&1:0,10,12,16,17,28,30,r| |
| | 2β-trans-eldecalcitol Usage And Synthesis |
| Uses | trans-Eldecalcitol is a derivative of vitamin D3 (V676045) which is the vitamin that mediates intestinal calcium absorbtion, bone calcium metabolism and probably, muscle activity. |
| | 2β-trans-eldecalcitol Preparation Products And Raw materials |
|