|
|
| | N-(4-Oxocyclohexyl)acetamide Basic information |
| | N-(4-Oxocyclohexyl)acetamide Chemical Properties |
| Melting point | 137 °C | | Boiling point | 359.1±31.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Solid | | pka | 15.76±0.20(Predicted) | | color | Off-white | | InChI | InChI=1S/C8H13NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h7H,2-5H2,1H3,(H,9,10) | | InChIKey | WZEMYWNHKFIVKE-UHFFFAOYSA-N | | SMILES | C(NC1CCC(=O)CC1)(=O)C | | CAS DataBase Reference | 27514-08-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-37/39 | | WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | N-(4-Oxocyclohexyl)acetamide Usage And Synthesis |
| Chemical Properties | White solid | | Uses | N-(4-Oxocyclohexyl)acetamide is a metabolite of (trans-N-(4-nitroxycyclohexyl)acetamide (CAS 137213-91-3). N-(4-Oxocyclohexyl)acetamide has been used as a reactant in the preparation of 2-Pyrimidinecarbonitrile derivatives as falcipain inhibitors and antiparasitic agents. |
| | N-(4-Oxocyclohexyl)acetamide Preparation Products And Raw materials |
| Preparation Products | Pramipexole impurity 7-->2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole-->TRANS-4-ACETAMIDOCYCLOHEXANOL-->N-cyclohexylacetamide-->N-(2-AMINO-5,6,7,8-TETRAHYDRO-6-QUINAZOLINYL)ACETAMIDE-->3-acetaMido-1,2,3,4-tetrahydrocarbazole-->N-(4-((4-methylphenyl)sulfonamido)phenyl)acetamide |
|