|
|
| | (S)-(+)-ALPHA-(TRIFLUOROMETHYL)BENZYL ALCOHOL Basic information |
| Product Name: | (S)-(+)-ALPHA-(TRIFLUOROMETHYL)BENZYL ALCOHOL | | Synonyms: | (S)-(+)-2,2,2-TRIFLUORO-1-PHENYLETHANOL;(S)-2,2,2-TRIFLUORO-1-PHENYL-ETHANOL;(S)-(+)-1-PHENYL-2,2,2-TRIFLUOROETHANOL;(S)-(+)-ALPHA-(TRIFLUOROMETHYL)BENZYL ALCOHOL;(+)-PHENYL(TRIFLUOROMETHYL)CARBINOL;(S)-(+)-ALPHA-(TRIFLUOROMETHYL)BENZYL AL COHOL, 99% (97% EE/GLC);(s)-(+)-α-(trifluoromethyl)benzyl alcohol;(+)-Phenyl(trifluoromethyl)carbinol, (S)-(+)-1-Phenyl-2,2,2-trifluoroethanol | | CAS: | 340-06-7 | | MF: | C8H7F3O | | MW: | 176.14 | | EINECS: | 206-430-7 | | Product Categories: | Alcohols, Hydroxy Esters and Derivatives;Chiral Compounds | | Mol File: | 340-06-7.mol |  |
| | (S)-(+)-ALPHA-(TRIFLUOROMETHYL)BENZYL ALCOHOL Chemical Properties |
| Boiling point | 73-76 °C9 mm Hg(lit.) | | density | 1.3 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.462(lit.) | | Fp | 184 °F | | storage temp. | Inert atmosphere,Room Temperature | | pka | 11.91±0.10(Predicted) | | form | Liquid | | color | Clear colorless to pale yellow | | Optical Rotation | [α]20/D +31.3±0.5°, neat | | BRN | 2327547 | | InChI | 1S/C8H7F3O/c9-8(10,11)7(12)6-4-2-1-3-5-6/h1-5,7,12H/t7-/m0/s1 | | InChIKey | VNOMEAQPOMDWSR-ZETCQYMHSA-N | | SMILES | O[C@@H](c1ccccc1)C(F)(F)F |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | F | 10-23 | | HS Code | 29062990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-(+)-ALPHA-(TRIFLUOROMETHYL)BENZYL ALCOHOL Usage And Synthesis |
| Uses | (S)?-?(+)?-?α-?(Trifluoromethyl)?benzyl Alcohol is used in the synthesis of metal-organic framework compounds which may have mesoporous properties. | | Purification Methods | Purify the chiral alcohols by fractional distillation preferably in a vacuum. [Morrison & Ridgeway Tetrahedron Lett 573 1969, NMR: Pirkle & Beare J Am Chem Soc 90 6250 1968.] The racemate [340-05-6] has b 52-54o/2mm,57-59o/2mm, 64-65o/5mm, d 4 20 1.293, n D 20 1.457, and the 2-carbobenzoyl derivative has m 137-138o [Mosher et al. J Am Chem Soc 78 4374 1956]. [Beilstein 6 IV 3043.] |
| | (S)-(+)-ALPHA-(TRIFLUOROMETHYL)BENZYL ALCOHOL Preparation Products And Raw materials |
|