|
|
| | FMOC-SER(TBU)-THR(PSIME,MEPRO)-OH Basic information |
| Product Name: | FMOC-SER(TBU)-THR(PSIME,MEPRO)-OH | | Synonyms: | FMOC-SER(TBU)-THR(PSIME,MEPRO)-OH;Fmoc-L-Ser(tBu)-L-Thr[PSI(Me,Me)Pro]-OH;(4S,5R)-3-[Nα-(9-Fluorenylmethyloxycarbonyl)-O-tert-butyl-L-serinyl]-2,2,5-trimethyloxazolidine-4-carboxylic acid;Fmoc-Ser(tBu)-Thr[Psi(Me,Me)Pro]-OH≥ 99% (HPLC);Fmoc-Ser(tBu)-Thr[Ψ(Me,Me)Pro]-OH;(9H-Fluoren-9-yl)MethOxy]Carbonyl Ser(tBu)-ThrPsi(Me, Me)Pro-OH;(4S,5R)-3-[(2S)-3-(1,1-Dimethylethoxy)-2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-1-oxopropyl]-2,2,5-trimethyl-4-oxazolidinecarboxylic acid;(4S,5R)-3-[(2S)-3-(tert-butoxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanoyl]-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid | | CAS: | 1266350-99-5 | | MF: | C29H36N2O7 | | MW: | 524.61 | | EINECS: | | | Product Categories: | peptide | | Mol File: | Mol File |  |
| | FMOC-SER(TBU)-THR(PSIME,MEPRO)-OH Chemical Properties |
| Boiling point | 717.1±60.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | Store at +2°C to +8°C. | | pka | 3.04±0.60(Predicted) | | form | powder | | Major Application | peptide synthesis | | InChIKey | AVAILEBHPYBEGO-CQLNOVPUSA-N | | SMILES | O1[C@H](C)[C@@H](C(O)=O)N(C(=O)[C@@H](NC(OCC2C3=C(C=CC=C3)C3=C2C=CC=C3)=O)COC(C)(C)C)C1(C)C |
| WGK Germany | WGK 2 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | FMOC-SER(TBU)-THR(PSIME,MEPRO)-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-SER(TBU)-THR(PSIME,MEPRO)-OH Preparation Products And Raw materials |
|