|
|
| | 2-CHLORO-1H-INDOLE-3-CARBALDEHYDE Basic information |
| | 2-CHLORO-1H-INDOLE-3-CARBALDEHYDE Chemical Properties |
| Melting point | ca 212℃ | | Boiling point | 364.7±22.0 °C(Predicted) | | density | 1.431±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 13.90±0.30(Predicted) | | color | Yellow to brown | | Water Solubility | Slightly soluble in water. | | Sensitive | Air Sensitive | | InChI | InChI=1S/C9H6ClNO/c10-9-7(5-12)6-3-1-2-4-8(6)11-9/h1-5,11H | | InChIKey | XYSSNBNFOBVMAU-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C(C=O)=C1Cl | | CAS DataBase Reference | 5059-30-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | HazardClass | IRRITANT | | HS Code | 2933998090 |
| | 2-CHLORO-1H-INDOLE-3-CARBALDEHYDE Usage And Synthesis |
| Uses | It is used as pharmaceutical intermediates. It is used in the synthesis of indole phytoalexin cyclobrassinon. And also in unprecedented chemical structure and biomimetic synthesis of erucalexin, a phytoalexin from the wild crucifer Erucastrum gallicum. |
| | 2-CHLORO-1H-INDOLE-3-CARBALDEHYDE Preparation Products And Raw materials |
|