|
|
| | 5-BROMOINDOLE-3-ACETIC ACID Basic information |
| | 5-BROMOINDOLE-3-ACETIC ACID Chemical Properties |
| Melting point | 143-145 °C (lit.) | | Boiling point | 466.0±30.0 °C(Predicted) | | density | 1.6254 (rough estimate) | | refractive index | 1.6320 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Crystalline Powder | | pka | 4.36±0.30(Predicted) | | color | Off-white to beige | | InChI | 1S/C10H8BrNO2/c11-7-1-2-9-8(4-7)6(5-12-9)3-10(13)14/h1-2,4-5,12H,3H2,(H,13,14) | | InChIKey | WTFGHMZUJMRWBK-UHFFFAOYSA-N | | SMILES | OC(=O)Cc1c[nH]c2ccc(Br)cc12 | | CAS DataBase Reference | 40432-84-6(CAS DataBase Reference) |
| | 5-BROMOINDOLE-3-ACETIC ACID Usage And Synthesis |
| Chemical Properties | OFF-WHITE TO BEIGE CRYSTALLINE POWDER | | Uses | 5-Bromoindole-3-acetic Acid can be used as reactant/reagent for design and synthesis and evaluation of novel auxin mimic herbicides for weed control activity. | | Synthesis Reference(s) | Tetrahedron Letters, 35, p. 3013, 1994 DOI: 10.1016/S0040-4039(00)76815-8 |
| | 5-BROMOINDOLE-3-ACETIC ACID Preparation Products And Raw materials |
|