|
|
| | 2-AMINO-3,5-DIIODOBENZOIC ACID Basic information |
| Product Name: | 2-AMINO-3,5-DIIODOBENZOIC ACID | | Synonyms: | 2-AMINO-3,5-DIIODOBENZOIC ACID;3,5-DIIODO-2-AMINOBENZOIC ACID;3,5-DIIODOANTHRANILIC ACID;2-Amino-3,5-diiodobenzoic acid, 98+%;3,5-diiodo-anthranilicaci;Anthranilic acid, 3,5-diiodo-;Benzoic acid, 2-amino-3,5-diiodo-;3,5-Diiodoanthanilic acid | | CAS: | 609-86-9 | | MF: | C7H5I2NO2 | | MW: | 388.93 | | EINECS: | 210-201-7 | | Product Categories: | Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Acids & Esters;Anilines, Amides & Amines;Iodine Compounds | | Mol File: | 609-86-9.mol |  |
| | 2-AMINO-3,5-DIIODOBENZOIC ACID Chemical Properties |
| Melting point | 241-243 °C(lit.) | | Boiling point | 441.9±45.0 °C(Predicted) | | density | 2.3815 (estimate) | | pka | 4.24±0.10(Predicted) | | form | powder to crystal | | color | White to Gray to Brown | | Sensitive | Light Sensitive | | BRN | 779429 | | InChI | InChI=1S/C7H5I2NO2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,10H2,(H,11,12) | | InChIKey | RFIBDMCPIREZKC-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(I)=CC(I)=C1N | | CAS DataBase Reference | 609-86-9(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 2-amino-3,5-diiodo- (609-86-9) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | CB2999300 | | TSCA | Yes | | HS Code | 29224985 | | Toxicity | LD50 unr-rat: 180 mg/kg JAPMA8 42,721,53 |
| | 2-AMINO-3,5-DIIODOBENZOIC ACID Usage And Synthesis |
| Safety Profile | Poison by an unspecified route.Moderately toxic by ingestion. When heated todecomposition it emits toxic vapors of NOx. |
| | 2-AMINO-3,5-DIIODOBENZOIC ACID Preparation Products And Raw materials |
|