|
|
| | SUDAN ORANGE G Basic information |
| Product Name: | SUDAN ORANGE G | | Synonyms: | C.I. Food Orange 3;C.I. Solvent Orange 1;c.i.foodorange3;4-Phenylazo-benzene-1,3-diol;SUDAN ORANGE G C.I.NO.11920;Sudan Orange G, pure;4-(PHENYLAZO)-1,3-BENZENEDIOL;2,4-Dihydroxyazobenzene, 4-(Phenylazo)resorcinol, SOG | | CAS: | 2051-85-6 | | MF: | C12H10N2O2 | | MW: | 214.22 | | EINECS: | 218-131-9 | | Product Categories: | Organics | | Mol File: | 2051-85-6.mol |  |
| | SUDAN ORANGE G Chemical Properties |
| Melting point | 143-146 °C(lit.) | | Boiling point | 354.35°C (rough estimate) | | density | 1.2042 (rough estimate) | | refractive index | 1.6660 (estimate) | | storage temp. | Amber Vial, Refrigerator, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (slightly) | | pka | 8.77±0.18(Predicted) | | Colour Index | 11920 | | form | Powder | | color | Red-orange | | Water Solubility | 0.2g/L(20 ºC) | | λmax | 388 nm | | BRN | 958430 | | Major Application | cleaning products cosmetics food and beverages personal care | | Cosmetics Ingredients Functions | HAIR DYEING COLORANT | | InChI | 1S/C12H10N2O2/c15-10-6-7-11(12(16)8-10)14-13-9-4-2-1-3-5-9/h1-8,15-16H/b14-13+ | | InChIKey | BPTKLSBRRJFNHJ-BUHFOSPRSA-N | | SMILES | Oc1ccc(\N=N\c2ccccc2)c(O)c1 | | LogP | 1.003 (est) | | EPA Substance Registry System | 1,3-Benzenediol, 4-(phenylazo)- (2051-85-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | CZ9027500 | | TSCA | TSCA listed | | HS Code | 32041200 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | SUDAN ORANGE G Usage And Synthesis |
| Chemical Properties | red-orange powder | | Uses | Sudan Orange G is an oil soluble synthetic dye. Sudan Orange G can be degraded by a bacterial strain known as Pseudomonas putida MET94. Dyes and metabolites, Environmental Testing | | Preparation | aniline diazo, Coupled with resorcinol. | | Properties and Applications | bright orange. Yellow orange powder, melting point: 150 ~ 170 ℃ (usually products do not pure). Soluble in ethanol and aether (yellow), in the ethanol solubility of 0.2 ~ 0.3 g / 100ml, slightly soluble in water, but soluble in vegetable oil. The strong sulfuric acid to red light brown, for yellow brown solution diluted, and then into a dark orange precipitation; In 2% of sodium hydroxide solution (heating) for orange brown solution. Its water solution and strong hydrochloric acid color the darker, and then generate a shallow brown precipitation. Sun of resistance, alkali resistance is bad. And C.I.Solvent Orange 1?the same chemical structure. | | Purification Methods | Crystallise the dye from hot EtOH (charcoal). [Beilstein 16 IV 264.] |
| | SUDAN ORANGE G Preparation Products And Raw materials |
|