|
| 2-Butyl-3-(3,5-Diiodo-4-hydroxy benzoyl) benzofuran Basic information |
| 2-Butyl-3-(3,5-Diiodo-4-hydroxy benzoyl) benzofuran Chemical Properties |
Melting point | 142-144°C | Boiling point | 536.8±50.0 °C(Predicted) | density | 1.864 | storage temp. | Refrigerator | solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) | form | Solid | pka | 4.84±0.25(Predicted) | color | Off-White to Pale Beige | InChI | InChI=1S/C19H16I2O3/c1-2-3-7-16-17(12-6-4-5-8-15(12)24-16)18(22)11-9-13(20)19(23)14(21)10-11/h4-6,8-10,23H,2-3,7H2,1H3 | InChIKey | PNFMEGSMKIHDFZ-UHFFFAOYSA-N | SMILES | C(C1C2=CC=CC=C2OC=1CCCC)(C1=CC(I)=C(O)C(I)=C1)=O | CAS DataBase Reference | 1951-26-4(CAS DataBase Reference) |
WGK Germany | 3 | HS Code | 2932996560 |
| 2-Butyl-3-(3,5-Diiodo-4-hydroxy benzoyl) benzofuran Usage And Synthesis |
Chemical Properties | Off-White Solid | Uses | 2-Butyl-3-(3,5-diiodo-4-hydroxybenzoyl)benzofuran (Amiodarone EP Impurity D) is a related compound of Amiodarone, a non-selective ion channel blocker. | Definition | ChEBI: (2-Butylbenzofuran-3-yl)(4-hydroxy-3,5-diiodophenyl)ketone is a member of benzofurans. |
| 2-Butyl-3-(3,5-Diiodo-4-hydroxy benzoyl) benzofuran Preparation Products And Raw materials |
|