| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
CM037 manufacturers
- CM037
-
- $34.00
-
2026-08-08
- CAS:896795-60-1
- Purity: 99.77%
- Supply Ability: 10g
|
| Product Name: | CM037 | | Synonyms: | CM037;Ethyl 2-[[3,4-dihydro-4-oxo-3-[3-(1-pyrrolidinyl)propyl][1]benzothieno[3,2-d]pyrimidin-2-yl]thio]acetate;A37;Acetic acid, 2-[[3,4-dihydro-4-oxo-3-[3-(1-pyrrolidinyl)propyl][1]benzothieno[3,2-d]pyrimidin-2-yl]thio]-, ethyl ester;Ethyl 2-((4-oxo-3-(3-(pyrrolidin-1-yl)propyl)-3,4-dihydrobenzo[4,5]thieno[3,2-d]pyrimidin-2-yl)thio)acetate;CM037, 10 mM in DMSO;ALDH1A1, A37 | | CAS: | 896795-60-1 | | MF: | C21H25N3O3S2 | | MW: | 431.57 | | EINECS: | | | Product Categories: | | | Mol File: | 896795-60-1.mol |  |
| | CM037 Chemical Properties |
| Melting point | >99°C (dec.) | | Boiling point | 602.5±65.0 °C(Predicted) | | density | 1.38±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 10.11±0.20(Predicted) | | form | Solid | | color | Off-White to Light Beige | | InChI | 1S/C21H25N3O3S2/c1-2-27-17(25)14-28-21-22-18-15-8-3-4-9-16(15)29-19(18)20(26)24(21)13-7-12-23-10-5-6-11-23/h3-4,8-9H,2,5-7,10-14H2,1H3 | | InChIKey | SKDRHRAYBYQVNU-UHFFFAOYSA-N | | SMILES | O=C1N(CCCN2CCCC2)C(SCC(OCC)=O)=NC3=C1SC4=CC=CC=C43 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | CM037 Usage And Synthesis |
| Uses | CM037 is a novel selective aldehyde dehydrogenase 1A1 (ALDH1A1) inhibitor, binding within the aldehyde binding pocket of ALDH1A1 in a competitive mode of inhibition. | | Biological Activity | CM037 is a potent and selective inhibitor of human aldehyde dehydrogenase 1A1 (ALDH1A1). CM037 binds to the aldehyde binding pocket of ALDH1A1. | | IC 50 | ALDH1 | | storage | Store at +4°C |
| | CM037 Preparation Products And Raw materials |
|