| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Pyracarbolid CAS:24691-76-7 Package:1ML
|
|
| | PYRACARBOLID Basic information |
| | PYRACARBOLID Chemical Properties |
| Melting point | 110-111° | | Boiling point | 357.82°C (rough estimate) | | density | 1.0960 (rough estimate) | | refractive index | 1.5300 (estimate) | | pka | 14.41±0.70(Predicted) | | Water Solubility | 0.6g/L(40 ºC) | | Merck | 13,8044 | | BRN | 1427914 | | Major Application | agriculture environmental | | InChI | 1S/C13H15NO2/c1-10-9-11(7-8-16-10)13(15)14-12-5-3-2-4-6-12/h2-6,9,11H,7-8H2,1H3,(H,14,15) | | InChIKey | RVUAOAREEJAWAM-UHFFFAOYSA-N | | SMILES | O=C(NC=1C=CC=CC1)C2=C(OCCC2)C |
| Risk Statements | 52/53 | | Safety Statements | 61 | | WGK Germany | 3 | | RTECS | UP7985000 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 3 |
| | PYRACARBOLID Usage And Synthesis |
| Uses | Agricultural fungicide. | | Uses | Pyracarbolid is a systemic fungicide for bean rust control. | | Definition | ChEBI: Pyracarbolid is an anilide and an anilide fungicide. |
| | PYRACARBOLID Preparation Products And Raw materials |
|