|
|
| | 3,5-Difluorobenzaldehyde Basic information |
| Product Name: | 3,5-Difluorobenzaldehyde | | Synonyms: | 3,5-DIFLUOROBENZALDEHYDE;3,5-Difluorobenzaldehyde,97%;3,5-Difluorobenzaldehyde, 98+%;3,5-Difluorobenzaldehyde 98%;3,5-Difluorobenzalde;1,2-DiFluorobenzenebenzaldehyde;1,3-Difluoro-5-formylbenzene;3,5-fluorobenzaldehyde | | CAS: | 32085-88-4 | | MF: | C7H4F2O | | MW: | 142.1 | | EINECS: | 608-701-9 | | Product Categories: | Fluorine series;Aldehydes;C7;Carbonyl Compounds;Aromatic Aldehydes & Derivatives (substituted);Miscellaneous;Fluorobenzaldehyde Series;bc0001;intermediate | | Mol File: | 32085-88-4.mol |  |
| | 3,5-Difluorobenzaldehyde Chemical Properties |
| Melting point | 17°C | | Boiling point | 61-63°C 43mm | | density | 1.296 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.493(lit.) | | Fp | 133 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Liquid After Melting | | color | Clear light green | | Sensitive | Air Sensitive | | BRN | 2573392 | | InChI | InChI=1S/C7H4F2O/c8-6-1-5(4-10)2-7(9)3-6/h1-4H | | InChIKey | ASOFZHSTJHGQDT-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(F)=CC(F)=C1 | | CAS DataBase Reference | 32085-88-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | RIDADR | UN 1989 3/PG 3 | | WGK Germany | 3 | | F | 10-21 | | Hazard Note | Irritant | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29124990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 |
| | 3,5-Difluorobenzaldehyde Usage And Synthesis |
| Chemical Properties | clearlightgreenliqui | | Uses | The 19F{′H} spectra of 3,5-difluorobenzaldehyde at low temperature in dimethyl ether solution was studied. | | Synthesis Reference(s) | Journal of Medicinal Chemistry, 30, p. 486, 1987 DOI: 10.1021/jm00386a008 | | General Description | The 19F{′H} spectra of 3,5-difluorobenzaldehyde at low temperature in dimethyl ether solution was studied. |
| | 3,5-Difluorobenzaldehyde Preparation Products And Raw materials |
|