| Company Name: |
Tianjin Xinghan Biotechnology Co., Ltd Gold
|
| Tel: |
13230698506 18698089028 |
| Email: |
1725517238@qq.com |
| Products Intro: |
Product Name:2-(3,5-dichlorophenyl)pyrrolidine hydrochloride
CAS:887344-13-0
Purity:97% Package:1g,5g,10g,100g,1kg,10kg
|
| Company Name: |
Chemsky（shanghai）International Co.,Ltd.
|
| Tel: |
021-50135380 |
| Email: |
shchemsky@sina.com |
| Products Intro: |
Product Name:2-(3,5-Dichlorophenyl)Pyrrolidine
CAS:887344-13-0
Purity:98%+ Package:1884RMB/100MG; 2750RMB/250MG; 5500RMB/1G
|
|
| | 2-(3,5-Dichlorophenyl)Pyrrolidine Basic information |
| Product Name: | 2-(3,5-Dichlorophenyl)Pyrrolidine | | Synonyms: | 2-[3,5-DICHLOROPHENYL]PYRROLIDINE;2-(3,5-Dichlorophenyl)tetrahydropyrrole, 1,3-Dichloro-5-(pyrrolidin-2-yl)benzene;Pyrrolidine, 2-(3,5-dichlorophenyl)- | | CAS: | 887344-13-0 | | MF: | C10H11Cl2N | | MW: | 216.11 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2-(3,5-Dichlorophenyl)Pyrrolidine Chemical Properties |
| density | 1.250 | | form | Liquid | | InChI | InChI=1S/C10H11Cl2N/c11-8-4-7(5-9(12)6-8)10-2-1-3-13-10/h4-6,10,13H,1-3H2 | | InChIKey | RGJUGOHYPAYSDI-UHFFFAOYSA-N | | SMILES | N1CCCC1C1=CC(Cl)=CC(Cl)=C1 |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2933998090 |
| | 2-(3,5-Dichlorophenyl)Pyrrolidine Usage And Synthesis |
| Uses | Used as an intermediate for organic synthesis. | | Biological Activity | 2-(3,5-Dichlorophenyl)Pyrrolidine has been shown to act as a dopamine transporter inhibitor, which means that it blocks the reuptake of dopamine in the brain and increases its concentration in the synaptic cleft. This mechanism of action is similar to that of cocaine and other psychostimulants, and may contribute to the compound's bioactivity and potency. The compound has been shown to increase the release of dopamine and other neurotransmitters in the brain, which can lead to euphoria, increased energy, and improved cognitive function. However, chronic use of dopamine transporter inhibitors has been associated with neurotoxicity, addiction, and other adverse effects. | | Synthesis | 2-(3,5-Dichlorophenyl)Pyrrolidine is prepared by reacting1-Bromo-3,5-dichlorobenzene with 1,1-Dimethylethyl 2-oxo-1-pyrrolidinecarboxylate:
 |
| | 2-(3,5-Dichlorophenyl)Pyrrolidine Preparation Products And Raw materials |
|