| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 3-Phenylbenzaldehyde
-
- $2.00
-
2026-08-25
- CAS:1204-60-0
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- 3-Phenylbenzaldehyde
-
-
2026-05-19
- CAS:1204-60-0
- Min. Order: 1kg
- Purity: 99.9% HPLC
- Supply Ability: 1tons
- 3-Phenylbenzaldehyde
-
- $1.00
-
2019-12-27
- CAS:1204-60-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kg
|
| | 3-Phenylbenzaldehyde Basic information |
| Product Name: | 3-Phenylbenzaldehyde | | Synonyms: | 3-Phenylbenzaldehyde, 3-Formylbiphenyl;3-Phenylbenzaldehyde≥ 98% (GC);BIPHENYL-3-CARBALDEHYDE;1,1'-BIPHENYL-3-CARBALDEHYDE;[1,1'-BIPHENYL]-3-CARBOXALDEHYDE;3-PHENYLBENZALDEHYDE;AKOS BBS-00001382;3-biphenylcarboxaldehyde | | CAS: | 1204-60-0 | | MF: | C13H10O | | MW: | 182.22 | | EINECS: | | | Product Categories: | API intermediates | | Mol File: | 1204-60-0.mol |  |
| | 3-Phenylbenzaldehyde Chemical Properties |
| Melting point | 167-168 °C | | Boiling point | 125°C/1mmHg(lit.) | | density | 1.118 g/mL at 25 °C | | refractive index | 1.6290-1.6330 | | Fp | >110℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Sensitive | Air Sensitive | | InChI | InChI=1S/C13H10O/c14-10-11-5-4-8-13(9-11)12-6-2-1-3-7-12/h1-10H | | InChIKey | KFKSIUOALVIACE-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=CC=CC(C=O)=C1 | | CAS DataBase Reference | 1204-60-0(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 36/37/39 | | WGK Germany | 3 | | RTECS | DV1771500 | | Hazard Note | Irritant | | HS Code | 2912290090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 3-Phenylbenzaldehyde Usage And Synthesis |
| Chemical Properties | Light brown to yellow liquid | | Synthesis Reference(s) | The Journal of Organic Chemistry, 51, p. 3878, 1986 DOI: 10.1021/jo00370a024 |
| | 3-Phenylbenzaldehyde Preparation Products And Raw materials |
|