- FMOC-D-4-Chlorophe
-
- $10.00
-
2019-07-06
- CAS:142994-19-2
- Min. Order: 10KG
- Purity: 98%
- Supply Ability: 100kg
- FMOC-D-4-Chlorophe
-
- $1.00
-
2019-07-06
- CAS:142994-19-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | FMOC-D-4-Chlorophe Basic information |
| | FMOC-D-4-Chlorophe Chemical Properties |
| Melting point | 147.2 °C | | alpha | 30 º (c=1,DMF) | | Boiling point | 640.9±55.0 °C(Predicted) | | density | 1.1529 (rough estimate) | | refractive index | 1.6290 (estimate) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.72±0.10(Predicted) | | form | Powder | | color | White | | Optical Rotation | Consistent with structure | | BRN | 8726004 | | Major Application | peptide synthesis | | InChI | 1S/C24H20ClNO4/c25-16-11-9-15(10-12-16)13-22(23(27)28)26-24(29)30-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22H,13-14H2,(H,26,29)(H,27,28)/t22-/m1/s1 | | InChIKey | CQPNKLNINBUUOM-JOCHJYFZSA-N | | SMILES | C(O)(=O)[C@@H](CC1=CC=C(Cl)C=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | FMOC-D-4-Chlorophe Usage And Synthesis |
| Chemical Properties | off-white crystalline powder | | Uses | Fmoc-4-chloro-d-phenylalanine, is an amino acid derivative used in chemical synthesis and peptide chemistry. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-D-4-Chlorophe Preparation Products And Raw materials |
|