|
|
| | 5-Ethyl-2-pyridineethanol Basic information |
| | 5-Ethyl-2-pyridineethanol Chemical Properties |
| Melting point | 39-44℃ | | Boiling point | 127°C (5 mmHg) | | density | 0.042 g/cm3(Temp: 42 °C) | | vapor pressure | 0.062-1.16Pa at 25℃ | | refractive index | 1.53 | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform, Ethyl Acetate | | form | Solid | | pka | 14.53±0.10(Predicted) | | color | Pale Yellow | | BRN | 117340 | | InChI | InChI=1S/C9H13NO/c1-2-8-3-4-9(5-6-11)10-7-8/h3-4,7,11H,2,5-6H2,1H3 | | InChIKey | OUJMXIPHUCDRAS-UHFFFAOYSA-N | | SMILES | C1(CCO)=NC=C(CC)C=C1 | | LogP | 1.42 | | CAS DataBase Reference | 5223-06-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 21-36-36/37/38-41-37/38 | | Safety Statements | 26-36/37/39-36-39 | | WGK Germany | WGK 1 | | RTECS | UT3150000 | | REACH Registrations | Active | | HazardClass | IRRITANT | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Eye Dam. 1
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 5-Ethyl-2-pyridineethanol Usage And Synthesis |
| Chemical Properties | 5-Ethyl-2-pyridineethanol is White to Straw Yellow Crystals | | Uses | 5-Ethyl-2-pyridineethanol (cas# 5223-06-3) is a compound useful in organic synthesis. | | Uses | 2-(5-Ethyl-2-pyridyl)ethanol is used as building block in chemical synthesis. Product Data Sheet |
| | 5-Ethyl-2-pyridineethanol Preparation Products And Raw materials |
|