|
|
| | Noroxycodone-d3 hydrochloride Basic information |
| Product Name: | Noroxycodone-d3 hydrochloride | | Synonyms: | Noroxycodone-D;Noroxycodone-D3 hydrochloride solution;Noroxycodone-d3 hydrochloride | | CAS: | | | MF: | C17H17ClD3NO4 | | MW: | 340.82 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File | ![Noroxycodone-d3 hydrochloride Structure]() |
| | Noroxycodone-d3 hydrochloride Chemical Properties |
| Fp | 9 °C | | storage temp. | -20°C | | form | liquid | | Major Application | forensics and toxicology | | InChI | 1S/C17H19NO4.ClH/c1-21-11-3-2-9-8-12-17(20)5-4-10(19)15-16(17,6-7-18-12)13(9)14(11)22-15;/h2-3,12,15,18,20H,4-8H2,1H3;1H/t12-,15+,16+,17-;/m1./s1/i1D3; | | InChIKey | IGNAMRAQFUFUMH-HHAOZYOFSA-N | | SMILES | Cl.[2H]C([2H])([2H])Oc1ccc2C[C@H]3NCC[C@@]45[C@@H](Oc1c24)C(=O)CC[C@@]35O |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25-52/53 | | Safety Statements | 16-36/37-45-61-7 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Chronic 3
Flam. Liq. 2
STOT SE 1 |
| | Noroxycodone-d3 hydrochloride Usage And Synthesis |
| Uses | This stable-labeled certified reference solution is suitable for quantitation of noroxycodone levels in urine, serum, or plasma by LC/MS or GC/MS for applications such as urine drug testing, clinical toxicology, forensic analysis, pain prescription monitoring, or isotope dilution methods. Noroxycodone is a major urinary metabolite of oxycodone, an opiate analgesic drug used for the management of moderate to severe pain, both acute and chronic. |
| | Noroxycodone-d3 hydrochloride Preparation Products And Raw materials |
|